What is the molecularity of each reaction


The following mechanism has been proposed for the reaction of nitric oxide and chloride:

NO(g)+ Cl2(g)------NOCl2(g)

NO(g)+NOCl2(g)-----2NOCl(g)

a) What is the overall reaction?

b) Identify any reaction intermediate?

c) What is the molecularity of each reaction?

Solution Preview :

Prepared by a verified Expert
Chemistry: What is the molecularity of each reaction
Reference No:- TGS0702615

Now Priced at $10 (50% Discount)

Recommended (93%)

Rated (4.5/5)